cas: 134672-70-1 — see every product listed under this CAS number, including other names
3-(2,4-Difluorophenyl)propionic acid 95% (CAS 134672-70-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A692314-5g |
| cas | 134672-70-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 631.81 Pln | |
| Ambeed | 100g | 2172.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A692314 |
3-(2,4-difluorophenyl)propanoic acid (CAS 134672-70-1) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 3-(2,4-difluorophenyl)propanoic acid. InChIKey: XAPRKUUFZCSOTE-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)propanoic acid |
| InChIKey | XAPRKUUFZCSOTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CCC(=O)O |
Computed by PubChem (NCBI)