3-(2,6-Dichlorophenyl)acrylic acid, 99% (E)
cas: 5345-89-1 — see every product listed under this CAS number, including other names
3-(2,6-Dichlorophenyl)acrylic acid, 99% (E) (CAS 5345-89-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A302453-1g |
| cas | 5345-89-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 375.94 Pln | |
| Ambeed | 500g | 1555.19 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 147.75 Pln | |
| BLDpharm | 10g | 219.95 Pln | |
| BLDpharm | 25g | 253.27 Pln | |
| BLDpharm | 100g | 403.22 Pln | |
| BLDpharm | 500g | 1674.99 Pln |
properties
| purity | 99% (E) |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(2,6-dichlorophenyl)prop-2-enoic acid (CAS 5345-89-1) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: (E)-3-(2,6-dichlorophenyl)prop-2-enoic acid. InChIKey: OIPVGRCXMFBNAN-SNAWJCMRSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(2,6-dichlorophenyl)prop-2-enoic acid |
| InChIKey | OIPVGRCXMFBNAN-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichlorocinnamic acid, 3-(2,6-Dichlorophenyl)acrylic acid, (E)-3-(2,6-Dichlorophenyl)acrylic acid, 2,6-Dichlorocinnamic Acid, Predominantly Trans, 2,6-Dichloro-trans-cinnamic acid, (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid, 2-propenoic acid, 3-(2,6-dichlorophenyl)-, (2E)-, (E)-3-(2,6-dichlorophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(2,6-dichlorophenyl)-, 3-(2,6-dichlorophenyl)prop-2-enoic acid