CAS 27407-09-6 is the registry number for 7,8-Dichloro-3,4-dihydro-2h-1-benzopyran-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7,8-dichloro-2,3-dihydrochromen-4-one (CAS 27407-09-6) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 7,8-dichloro-2,3-dihydrochromen-4-one. InChIKey: JFQZFACTKZZVDU-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 7,8-dichloro-2,3-dihydrochromen-4-one |
| InChIKey | JFQZFACTKZZVDU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2Cl)Cl |
Computed by PubChem (NCBI)