cas: 870693-10-0 — see every product listed under this CAS number, including other names
3-(2-(4-Methoxyphenyl)-1H-indol-3-yl)propanoic acid, 97% (CAS 870693-10-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A218059-1g |
| cas | 870693-10-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4978.54 Pln | |
| AmBeed | 10g | 21312.13 Pln | |
| AmBeed | 5g | 14372.47 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoic acid (CAS 870693-10-0) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoic acid. InChIKey: AYISILBMVSEZSN-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoic acid |
| InChIKey | AYISILBMVSEZSN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)CCC(=O)O |
Computed by PubChem (NCBI)