cas: 206983-05-3 — see every product listed under this CAS number, including other names
3-(2-(Thiophen-2-yl)acetamido)benzoic acid, 97% (CAS 206983-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F725147-100MG |
| cas | 206983-05-3 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1455.76 Pln | |
| Fluorochem | 5g | 4366.19 Pln | |
| Fluorochem | 10g | 7026.71 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 822.80 Pln | |
| Chemat | 5g | 2843.60 Pln | |
| Chemat | 10g | 4806.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-[(2-thiophen-2-ylacetyl)amino]benzoic acid (CAS 206983-05-3) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: 3-[(2-thiophen-2-ylacetyl)amino]benzoic acid. InChIKey: QERCSVAAGLVTFH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 3-[(2-thiophen-2-ylacetyl)amino]benzoic acid |
| InChIKey | QERCSVAAGLVTFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)CC2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)