Products 905394-58-3

CAS 905394-58-3 is the registry number for 3-(5-Methylthiophene-3-carboxamido)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[(5-methylthiophene-3-carbonyl)amino]benzoic acid (CAS 905394-58-3) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: 3-[(5-methylthiophene-3-carbonyl)amino]benzoic acid. InChIKey: DTVFAWUQLQBVQN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO3S
Molecular weight261.30 g/mol
IUPAC name3-[(5-methylthiophene-3-carbonyl)amino]benzoic acid
InChIKeyDTVFAWUQLQBVQN-UHFFFAOYSA-N
SMILESCC1=CC(=CS1)C(=O)NC2=CC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)