CAS 887353-11-9 is the registry number for 2-Benzyloxy-5-nitrobenzenethiol (90%). Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
5-nitro-2-phenylmethoxybenzenethiol (CAS 887353-11-9) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: 5-nitro-2-phenylmethoxybenzenethiol. InChIKey: IKWZPZBLGGOXNT-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 5-nitro-2-phenylmethoxybenzenethiol |
| InChIKey | IKWZPZBLGGOXNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)[N+](=O)[O-])S |
Computed by PubChem (NCBI)