Products 151721-35-6
CAS 151721-35-6 appears in our catalog under these names: N-(3-Formylphenyl)benzenesulfonamide, 95%, N-(3-formylphenyl)benzenesulfonamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
N-(3-formylphenyl)benzenesulfonamide (CAS 151721-35-6) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: N-(3-formylphenyl)benzenesulfonamide. InChIKey: XYNPRCCUVAUTHD-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | N-(3-formylphenyl)benzenesulfonamide |
| InChIKey | XYNPRCCUVAUTHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)