Products 219708-08-4

CAS 219708-08-4 is the registry number for 4-(5-Methylthiophene-2-carboxamido)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(5-methylthiophene-2-carbonyl)amino]benzoic acid (CAS 219708-08-4) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: 4-[(5-methylthiophene-2-carbonyl)amino]benzoic acid. InChIKey: RBRIXXUEGIZNPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO3S
Molecular weight261.30 g/mol
IUPAC name4-[(5-methylthiophene-2-carbonyl)amino]benzoic acid
InChIKeyRBRIXXUEGIZNPZ-UHFFFAOYSA-N
SMILESCC1=CC=C(S1)C(=O)NC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)