CAS 206983-05-3 appears in our catalog under these names: 3-(2-(Thiophen-2-yl)acetamido)benzoic acid, 95+%, 3-(2-(Thiophen-2-yl)acetamido)benzoic acid, 97%, 97%, 3-(2-(Thiophen-2-yl)acetamido)benzoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
3-[(2-thiophen-2-ylacetyl)amino]benzoic acid (CAS 206983-05-3) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: 3-[(2-thiophen-2-ylacetyl)amino]benzoic acid. InChIKey: QERCSVAAGLVTFH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 3-[(2-thiophen-2-ylacetyl)amino]benzoic acid |
| InChIKey | QERCSVAAGLVTFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)CC2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)