CAS 1260178-70-8 is the registry number for Methyl 2-(2,3-dihydrobenzofuran-5-yl)thiazole-4-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylate (CAS 1260178-70-8) is a chemical compound with the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. IUPAC name: methyl 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylate. InChIKey: ZXRIVTNEWTYXNJ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | methyl 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | ZXRIVTNEWTYXNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)