cas: 62423-73-8 — see every product listed under this CAS number, including other names
3-(2-Bromoacetyl)benzoic acid 98% (CAS 62423-73-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A379524-250mg |
| cas | 62423-73-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 787.56 Pln | |
| Ambeed | 25g | 2239.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A379524 |
3-(2-bromoacetyl)benzoic acid (CAS 62423-73-8) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 3-(2-bromoacetyl)benzoic acid. InChIKey: QKEFOVJZNPELQH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 3-(2-bromoacetyl)benzoic acid |
| InChIKey | QKEFOVJZNPELQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(=O)CBr |
Computed by PubChem (NCBI)