CAS 62423-73-8 appears in our catalog under these names: 3-(2-Bromoacetyl)benzoic acid, 95%, 3–(2–Bromoacetyl)benzoic acid, 3-(2-Bromoacetyl)benzoic acid 98%, 3-(2-Bromoacetyl)benzoic acid, 90%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
3-(2-bromoacetyl)benzoic acid (CAS 62423-73-8) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 3-(2-bromoacetyl)benzoic acid. InChIKey: QKEFOVJZNPELQH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 3-(2-bromoacetyl)benzoic acid |
| InChIKey | QKEFOVJZNPELQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(=O)CBr |
Computed by PubChem (NCBI)