CAS 119405-32-2 appears in our catalog under these names: 3-Bromo-4-hydroxycinnamic acid, 95%, 3-Bromo-4-hydroxycinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g.
3-(3-bromo-4-hydroxyphenyl)prop-2-enoic acid (CAS 119405-32-2) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 3-(3-bromo-4-hydroxyphenyl)prop-2-enoic acid. InChIKey: HOZXBZABAJSGDX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 3-(3-bromo-4-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | HOZXBZABAJSGDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=CC(=O)O)Br)O |
Computed by PubChem (NCBI)