Products 90484-52-9
CAS 90484-52-9 appears in our catalog under these names: Methyl 2-bromo-4-formylbenzoate, 95%, methyl 2-bromo-4-formylbenzoate, Methyl 2-bromo-4-formylbenzoate 95%, Methyl 2-bromo-4-formylbenzoate, 95%, 95%, Methyl 2-bromo-4-formylbenzoate, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Methyl 2-bromo-4-formylbenzoate (CAS 90484-52-9) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 2-bromo-4-formylbenzoate. InChIKey: HVGRXTUWUNHKJB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 2-bromo-4-formylbenzoate |
| InChIKey | HVGRXTUWUNHKJB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C=O)Br |
Computed by PubChem (NCBI)