CAS 750585-94-5 appears in our catalog under these names: Methyl 2-bromo-3-formylbenzoate, 95%, Methyl 2-bromo-3-formylbenzoate 95%, Benzoic acid, 2-bromo-3-formyl-, methyl ester, 95%, 95%, METHYL 2-BROMO-3-FORMYLBENZOATE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
Methyl 2-bromo-3-formylbenzoate (CAS 750585-94-5) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 2-bromo-3-formylbenzoate. InChIKey: CNQNIZZOOUMRHI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 2-bromo-3-formylbenzoate |
| InChIKey | CNQNIZZOOUMRHI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1Br)C=O |
Computed by PubChem (NCBI)