Products 1612219-56-3
CAS 1612219-56-3 appears in our catalog under these names: 5-Acetyl-2-bromobenzoic acid, 97%, 5-Acetyl-2-bromobenzoic acid, 98%, 5-Acetyl-2-bromobenzoic acid, 5-Acetyl-2-bromobenzoic acid, 98%, 98%, 5-Acetyl-2-bromobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 0,5g.
5-acetyl-2-bromobenzoic acid (CAS 1612219-56-3) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 5-acetyl-2-bromobenzoic acid. InChIKey: NTDNLRNROTVOPI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 5-acetyl-2-bromobenzoic acid |
| InChIKey | NTDNLRNROTVOPI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)