CAS 41177-72-4 appears in our catalog under these names: 5-Bromo-2,3-dihydrobenzofuran-7-carboxylic acid, 95%, 5-Bromo-2,3-dihydrobenzofuran-7-carboxylic acid, 5-Bromo-2,3-dihydrobenzo[b]furan-7-carboxylic acid, 97%, Variable anhydride content , 5-Bromo-2,3-dihydrobenzofuran-7-carboxylic Acid, >97.0%(T), 5-Bromo-2,3-dihydrobenzofuran-7-carboxylic acid 98%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, TCI, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 41177-72-4) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: LEBMKAXASFPSFA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | LEBMKAXASFPSFA-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2C(=O)O)Br |
Computed by PubChem (NCBI)