cas: 842973-74-4 — see every product listed under this CAS number, including other names
3-(2-Fluoro-phenyl)-isoxazole-5-carboxylic acid, 97% (CAS 842973-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027754-100MG |
| cas | 842973-74-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 935.11 Pln | |
| Fluorochem | 1g | 1856.66 Pln | |
| Fluorochem | 5g | 4980.56 Pln | |
| Fluorochem | 10g | 9911.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(2-fluorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 842973-74-4) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: BNNODLZYXWQEES-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | BNNODLZYXWQEES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)