CAS 33282-24-5 appears in our catalog under these names: 5-(4-Fluorophenyl)-3-isoxazolecarboxylic acid, 5-(4-Fluoro-phenyl)-isoxazole-3-carboxylic acid, 97%, 5–(4–Fluoro–phenyl)–isoxazole–3–carboxylic acid, 5-(4-Fluorophenyl)isoxazole-3-carboxylic Acid, >95.0%(HPLC)(T), 5-(4-Fluorophenyl)isoxazole-3-carboxylic acid 95%. Offered by: Biosynth, Combi-blocks, GLPBio, TCI, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 2000mg, 1000mg, 5g, 1g, 10g.
5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-24-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: OFWUBERMKPVMCT-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | OFWUBERMKPVMCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)