CAS 842973-74-4 appears in our catalog under these names: 3-(2-Fluorophenyl)isoxazole-5-carboxylic acid, 95%, 3-(2-Fluorophenyl)isoxazole-5-carboxylic acid 98%, 3-(2-Fluorophenyl)isoxazole-5-carboxylic acid, 98%, 98%, 3-(2-Fluoro-phenyl)-isoxazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
3-(2-fluorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 842973-74-4) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: BNNODLZYXWQEES-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | BNNODLZYXWQEES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)