CAS 618383-48-5 appears in our catalog under these names: 3–(4–Fluorophenyl)isoxazole–5–carboxylic acid, 3-(4-Fluorophenyl)isoxazole-5-carboxylic acid, 95%, 3-(4-Fluorophenyl)isoxazole-5-carboxylic acid, 98%, 98%, 3-(4-Fluoro-phenyl)-isoxazole-5-carboxylic acid, 97%, 3-(4-Fluorophenyl)isoxazole-5-carboxylic acid, 98%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-(4-fluorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 618383-48-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 3-(4-fluorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: RAPIFMAMJGZVMX-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | RAPIFMAMJGZVMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)