Products 36303-26-1

CAS 36303-26-1 is the registry number for 6-Fluoro-4-hydroxyquinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

6-fluoro-4-oxo-1H-quinoline-2-carboxylic acid (CAS 36303-26-1) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 6-fluoro-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: RHDREWQIVYIOGH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6FNO3
Molecular weight207.16 g/mol
IUPAC name6-fluoro-4-oxo-1H-quinoline-2-carboxylic acid
InChIKeyRHDREWQIVYIOGH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1F)C(=O)C=C(N2)C(=O)O

Computed by PubChem (NCBI)