CAS 288399-47-3 is the registry number for 2-Amino-6-fluoro-4-oxo-4h-chromene-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-amino-6-fluoro-4-oxochromene-3-carbaldehyde (CAS 288399-47-3) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 2-amino-6-fluoro-4-oxochromene-3-carbaldehyde. InChIKey: XXNARJSQOPJACL-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 2-amino-6-fluoro-4-oxochromene-3-carbaldehyde |
| InChIKey | XXNARJSQOPJACL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(=C(O2)N)C=O |
Computed by PubChem (NCBI)