Products 1167056-89-4
CAS 1167056-89-4 appears in our catalog under these names: 6-Fluoro-3-hydroxyquinoline-4-carboxylic acid, 6-Fluoro-3-hydroxyquinoline-4-carboxylic acid, 97%, 6-Fluoro-3-hydroxy-quinoline-4-carboxylic acid, 90%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 50mg, 0,5g, 5g, 10g, 100mg, 250mg, 1g.
6-fluoro-3-hydroxyquinoline-4-carboxylic acid (CAS 1167056-89-4) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 6-fluoro-3-hydroxyquinoline-4-carboxylic acid. InChIKey: UPTVMNMTVAWXBH-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 6-fluoro-3-hydroxyquinoline-4-carboxylic acid |
| InChIKey | UPTVMNMTVAWXBH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1F)C(=O)O)O |
Computed by PubChem (NCBI)