3-(2-chlorophenoxy)azetidine hydrochloride, 98%
cas: 1188375-01-0 — see every product listed under this CAS number, including other names
3-(2-chlorophenoxy)azetidine hydrochloride, 98% (CAS 1188375-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F359711-100MG |
| cas | 1188375-01-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 500mg | 716.43 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 3309.27 Pln | |
| Fluorochem | 10g | 6563.33 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(2-chlorophenoxy)azetidine;hydrochloride (CAS 1188375-01-0) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3-(2-chlorophenoxy)azetidine;hydrochloride. InChIKey: OIJASKMSOZDCSI-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3-(2-chlorophenoxy)azetidine;hydrochloride |
| InChIKey | OIJASKMSOZDCSI-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)