3-(3-Hydroxy-4-(methylamino)phenyl)acrylic acid, 95%
cas: 2918780-14-8 — see every product listed under this CAS number, including other names
3-(3-Hydroxy-4-(methylamino)phenyl)acrylic acid, 95% (CAS 2918780-14-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1H29PX-100mg |
| cas | 2918780-14-8 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1250.00 Pln | |
| Chemat | 5g | 2834.00 Pln | |
| Chemat | 10g | 4638.80 Pln | |
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1388.07 Pln | |
| Fluorochem | 1g | 2523.09 Pln | |
| Fluorochem | 5g | 9635.17 Pln | |
| Fluorochem | 10g | 16023.54 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(E)-3-[3-hydroxy-4-(methylamino)phenyl]prop-2-enoic acid (CAS 2918780-14-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (E)-3-[3-hydroxy-4-(methylamino)phenyl]prop-2-enoic acid. InChIKey: XCQUXVDGDZARJM-HWKANZROSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (E)-3-[3-hydroxy-4-(methylamino)phenyl]prop-2-enoic acid |
| InChIKey | XCQUXVDGDZARJM-HWKANZROSA-N |
| SMILES | CNC1=C(C=C(C=C1)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)