Products 2918780-14-8
CAS 2918780-14-8 is the registry number for 3-(3-Hydroxy-4-(methylamino)phenyl)acrylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(E)-3-[3-hydroxy-4-(methylamino)phenyl]prop-2-enoic acid (CAS 2918780-14-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (E)-3-[3-hydroxy-4-(methylamino)phenyl]prop-2-enoic acid. InChIKey: XCQUXVDGDZARJM-HWKANZROSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (E)-3-[3-hydroxy-4-(methylamino)phenyl]prop-2-enoic acid |
| InChIKey | XCQUXVDGDZARJM-HWKANZROSA-N |
| SMILES | CNC1=C(C=C(C=C1)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)