cas: 490021-97-1 — see every product listed under this CAS number, including other names
3-(4-Chlorophenoxy)azetidine hydrochloride, 97% (CAS 490021-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694832-100MG |
| cas | 490021-97-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 893.45 Pln | |
| Fluorochem | 250mg | 1174.60 Pln | |
| Fluorochem | 500mg | 1611.95 Pln | |
| Fluorochem | 1g | 2044.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-chlorophenoxy)azetidine;hydrochloride (CAS 490021-97-1) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3-(4-chlorophenoxy)azetidine;hydrochloride. InChIKey: QSNYTCGPOAJEFH-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3-(4-chlorophenoxy)azetidine;hydrochloride |
| InChIKey | QSNYTCGPOAJEFH-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)