cas: 98554-00-8 — see every product listed under this CAS number, including other names
3-(4-Chlorophenyl)-1H-1,2,4-triazol-5-amine, 95%, 95% (CAS 98554-00-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116UEU-100mg |
| cas | 98554-00-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1269.20 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4-chlorophenyl)-1H-1,2,4-triazol-3-amine (CAS 98554-00-8) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: ZZDNYRLLRFJEDN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | ZZDNYRLLRFJEDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NN2)N)Cl |
Computed by PubChem (NCBI)