CAS 54463-89-7 appears in our catalog under these names: 5-(2-Chloro-phenyl)-2h-[1,2,4]triazol-3-ylamine, 95%, 5-(2-Chlorophenyl)-4h-1,2,4-triazol-3-amine, 96%, 5-(2-Chlorophenyl)-4H-1,2,4-triazol-3-amine, 95+%, 5–(2–Chlorophenyl)–4H–1,2,4–triazol–3–amine, 5-(2-chlorophenyl)-4H-1,2,4-triazol-3-amine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg, 2,5g.
5-(2-chlorophenyl)-1H-1,2,4-triazol-3-amine (CAS 54463-89-7) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-(2-chlorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: LVSNWMVOAUEVKU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | LVSNWMVOAUEVKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)Cl |
Computed by PubChem (NCBI)