CAS 869942-81-4 is the registry number for 3-Chloro-2-(1h-1,2,4-triazol-1-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-chloro-2-(1,2,4-triazol-1-yl)aniline (CAS 869942-81-4) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 3-chloro-2-(1,2,4-triazol-1-yl)aniline. InChIKey: YOFRRPZMAXQKGJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-chloro-2-(1,2,4-triazol-1-yl)aniline |
| InChIKey | YOFRRPZMAXQKGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N2C=NC=N2)N |
Computed by PubChem (NCBI)