CAS 18671-95-9 appears in our catalog under these names: 6-Chloro-quinazoline-2,4-diamine, 95%, 6-Chloroquinazoline-2,4-diamine, 97%, 6-Chloroquinazoline-2,4-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
6-chloroquinazoline-2,4-diamine (CAS 18671-95-9) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 6-chloroquinazoline-2,4-diamine. InChIKey: ZMQPXDMCQOHVLV-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 6-chloroquinazoline-2,4-diamine |
| InChIKey | ZMQPXDMCQOHVLV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)