CAS 450399-92-5 appears in our catalog under these names: 5-Chloro-2-(1h-1,2,4-triazol-1-yl)aniline, 95%, 5-Chloro-2-(1H-1,2,4-triazol-1-yl)aniline, 95+%, 5-Chloro-2-(1H-1,2,4-triazol-1-yl)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g.
5-chloro-2-(1,2,4-triazol-1-yl)aniline (CAS 450399-92-5) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-chloro-2-(1,2,4-triazol-1-yl)aniline. InChIKey: HJSKDFBSZMCRAJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-chloro-2-(1,2,4-triazol-1-yl)aniline |
| InChIKey | HJSKDFBSZMCRAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)N2C=NC=N2 |
Computed by PubChem (NCBI)