CAS 1152552-07-2 appears in our catalog under these names: 6-Chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine, 95%, 6-Chloro-3-cyclopropyl-(1,2,4)triazolo(4,3-b)pyridazine, 95+%, 6-chloro-3-cyclopropyl-(1,2,4)triazolo(4,3-b)pyridazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 500mg, 5g, 2,5g, 250mg.
6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1152552-07-2) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: VJYULOBBCNCMJY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | VJYULOBBCNCMJY-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)