Products 885278-43-3
CAS 885278-43-3 appears in our catalog under these names: 5-(4-Chloro-3-methylphenyl)-2h-tetrazole, 95%, 5-(4-chloro-3-methylphenyl)-1H-1,2,3,4-tetrazole, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
5-(4-chloro-3-methylphenyl)-2H-tetrazole (CAS 885278-43-3) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-(4-chloro-3-methylphenyl)-2H-tetrazole. InChIKey: ZUXHJWVZUVPRFT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(4-chloro-3-methylphenyl)-2H-tetrazole |
| InChIKey | ZUXHJWVZUVPRFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NNN=N2)Cl |
Computed by PubChem (NCBI)