3-(4-Methoxyphenyl)cyclobutan-1-one, 97%
cas: 52498-02-9 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)cyclobutan-1-one, 97% (CAS 52498-02-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 2.5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKPO-50mg |
| cas | 52498-02-9 |
| size | 50mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 544.40 Pln | |
| Chemat | 100mg | 880.40 Pln | |
| Chemat | 250mg | 1533.20 Pln | |
| Chemat | 500mg | 2675.60 Pln | |
| Chemat | 1g | 3890.00 Pln | |
| Chemat | 5g | 13595.60 Pln | |
| Fluorochem | 50mg | 633.13 Pln | |
| Fluorochem | 100mg | 1023.62 Pln | |
| Fluorochem | 250mg | 1794.18 Pln | |
| Fluorochem | 500mg | 3356.13 Pln | |
| Fluorochem | 1g | 4506.76 Pln | |
| Fluorochem | 2.5g | 10962.82 Pln | |
| Fluorochem | 5g | 17481.36 Pln | |
| Fluorochem | 10g | 25884.65 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(4-methoxyphenyl)cyclobutan-1-one (CAS 52498-02-9) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-(4-methoxyphenyl)cyclobutan-1-one. InChIKey: LXEFTIJELDKOQB-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)cyclobutan-1-one |
| InChIKey | LXEFTIJELDKOQB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)C2 |
Computed by PubChem (NCBI)