cas: 6622-54-4 — see every product listed under this CAS number, including other names
3-(9H-Carbazol-9-yl)propanoic acid, 95%, 95% (CAS 6622-54-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FE1T-100mg |
| cas | 6622-54-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 856.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-carbazol-9-ylpropanoic acid (CAS 6622-54-4) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 3-carbazol-9-ylpropanoic acid. InChIKey: ZAJJJOMMWPVJMH-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 3-carbazol-9-ylpropanoic acid |
| InChIKey | ZAJJJOMMWPVJMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2CCC(=O)O |
Computed by PubChem (NCBI)