cas: 6622-54-4 — see every product listed under this CAS number, including other names
3-Carbazol-9-yl-propionic acid, 97% (CAS 6622-54-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F042244-250MG |
| cas | 6622-54-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1278.73 Pln | |
| Fluorochem | 2.5g | 2663.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-carbazol-9-ylpropanoic acid (CAS 6622-54-4) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 3-carbazol-9-ylpropanoic acid. InChIKey: ZAJJJOMMWPVJMH-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 3-carbazol-9-ylpropanoic acid |
| InChIKey | ZAJJJOMMWPVJMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2CCC(=O)O |
Computed by PubChem (NCBI)