cas: 697302-70-8 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-5-bromo-2-hydroxybenzaldehyde, ≥95%, ≥95% (CAS 697302-70-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11792B-100mg |
| cas | 697302-70-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1370.00 Pln | |
| Chemat | 250mg | 2157.20 Pln | |
| Chemat | 1g | 5301.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-hydroxy-3-phenylmethoxybenzaldehyde (CAS 697302-70-8) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 5-bromo-2-hydroxy-3-phenylmethoxybenzaldehyde. InChIKey: QDFREXKCUIXEIS-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 5-bromo-2-hydroxy-3-phenylmethoxybenzaldehyde |
| InChIKey | QDFREXKCUIXEIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2O)C=O)Br |
Computed by PubChem (NCBI)