CAS 17054-27-2 appears in our catalog under these names: 3-Benzyloxy-4-bromobenzoic acid, 98%, 3-(Benzyloxy)-4-bromobenzoic acid 98%, 3-Benzyloxy-4-bromobenzoic acid, 98%, 98%, 3-(Benzyloxy)-4-bromobenzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg.
4-bromo-3-phenylmethoxybenzoic acid (CAS 17054-27-2) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 4-bromo-3-phenylmethoxybenzoic acid. InChIKey: KZTGRPMLINNFLJ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 4-bromo-3-phenylmethoxybenzoic acid |
| InChIKey | KZTGRPMLINNFLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)