CAS 1215205-39-2 appears in our catalog under these names: 3'-Bromo-5'-methoxybiphenyl-3-carboxylic acid, 95%, 3'-Bromo-5'-methoxybiphenyl-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(3-bromo-5-methoxyphenyl)benzoic acid (CAS 1215205-39-2) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 3-(3-bromo-5-methoxyphenyl)benzoic acid. InChIKey: HKWZVMVNLVXIAG-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 3-(3-bromo-5-methoxyphenyl)benzoic acid |
| InChIKey | HKWZVMVNLVXIAG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)Br |
Computed by PubChem (NCBI)