CAS 1215206-32-8 appears in our catalog under these names: 3'-Bromo-4'-methoxybiphenyl-3-carboxylic acid, 96%, 3'-Bromo-4'-methoxybiphenyl-3-carboxylic acid, 98%, 3-Bromo-4-methoxybiphenyl-3-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 500mg.
3-(3-bromo-4-methoxyphenyl)benzoic acid (CAS 1215206-32-8) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 3-(3-bromo-4-methoxyphenyl)benzoic acid. InChIKey: AAYOTNRWOUSBAC-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 3-(3-bromo-4-methoxyphenyl)benzoic acid |
| InChIKey | AAYOTNRWOUSBAC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=CC=C2)C(=O)O)Br |
Computed by PubChem (NCBI)