Products 1215205-67-6

CAS 1215205-67-6 is the registry number for 2'-Bromo-5'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(2-bromo-5-methoxyphenyl)benzoic acid (CAS 1215205-67-6) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 3-(2-bromo-5-methoxyphenyl)benzoic acid. InChIKey: PNVILPFIXBRYAL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BrO3
Molecular weight307.14 g/mol
IUPAC name3-(2-bromo-5-methoxyphenyl)benzoic acid
InChIKeyPNVILPFIXBRYAL-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)Br)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)