CAS 21120-75-2 appears in our catalog under these names: 4-(4-Bromo-phenoxy)-benzoic acid methyl ester, 95%, Methyl 4-(4-bromophenoxy)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Methyl 4-(4-bromophenoxy)benzoate (CAS 21120-75-2) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: methyl 4-(4-bromophenoxy)benzoate. InChIKey: GVUFCGJTPGPJRO-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | methyl 4-(4-bromophenoxy)benzoate |
| InChIKey | GVUFCGJTPGPJRO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)