Products 1215206-38-4

CAS 1215206-38-4 is the registry number for 2'-Bromo-4'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(2-bromo-4-methoxyphenyl)benzoic acid (CAS 1215206-38-4) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 3-(2-bromo-4-methoxyphenyl)benzoic acid. InChIKey: ALOQAXGURYOTCY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BrO3
Molecular weight307.14 g/mol
IUPAC name3-(2-bromo-4-methoxyphenyl)benzoic acid
InChIKeyALOQAXGURYOTCY-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=CC(=CC=C2)C(=O)O)Br

Computed by PubChem (NCBI)