cas: 117523-29-2 — see every product listed under this CAS number, including other names
3-(Benzyloxy)pyridine-2-carboxylic acid, 99% (CAS 117523-29-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637594-1G |
| cas | 117523-29-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3746.62 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
3-phenylmethoxypyridine-2-carboxylic acid (CAS 117523-29-2) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-phenylmethoxypyridine-2-carboxylic acid. InChIKey: MWHFMAMJIYHCLW-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-phenylmethoxypyridine-2-carboxylic acid |
| InChIKey | MWHFMAMJIYHCLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)C(=O)O |
Computed by PubChem (NCBI)