CAS 149505-88-4 appears in our catalog under these names: Methyl 6-carbamoylnaphthalene-2-carboxylate, 95%, Methyl 6-carbamoyl-2-naphthoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Methyl 6-carbamoylnaphthalene-2-carboxylate (CAS 149505-88-4) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: methyl 6-carbamoylnaphthalene-2-carboxylate. InChIKey: FRSDNJDYURVPCW-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | methyl 6-carbamoylnaphthalene-2-carboxylate |
| InChIKey | FRSDNJDYURVPCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)