Products 263270-34-4
CAS 263270-34-4 appears in our catalog under these names: 5-(Benzyloxy)pyridine-3-carboxylic acid, 95%, 5-(Benzyloxy)pyridine-3-carboxylic acid, ≥95%, ≥95%, 5-(Benzyloxy)nicotinic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
5-phenylmethoxypyridine-3-carboxylic acid (CAS 263270-34-4) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 5-phenylmethoxypyridine-3-carboxylic acid. InChIKey: MWWYJDHPRJSMBL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 5-phenylmethoxypyridine-3-carboxylic acid |
| InChIKey | MWWYJDHPRJSMBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CN=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)