CAS 57771-89-8 is the registry number for 2-Methyl-6-oxo-1,2-dihydro-6h-pyrrolo[3,2,1-ij]quinoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid (CAS 57771-89-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 2-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid. InChIKey: WTGRJHKPPOBGIZ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid |
| InChIKey | WTGRJHKPPOBGIZ-UHFFFAOYSA-N |
| SMILES | CC1CC2=C3N1C=C(C(=O)C3=CC=C2)C(=O)O |
Computed by PubChem (NCBI)